C12H22F2O3S — CID 105101775
1-(4,4-difluorocyclohexyl)-4-ethylsulfonylbutan-1-ol (PubChem CID 105101775) has the molecular formula C12H22F2O3S and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 105101775 |
| Molecular Formula | C12H22F2O3S |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H22F2O3S/c1-2-18(16,17)9-3-4-11(15)10-5-7-12(13,14)8-6-10/h10-11,15H,2-9H2,1H3 |
| InChIKey | TZBWTELYEHESGL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |