C12H22F2O4S — CID 103147710
3-(2,2-difluoroethoxy)-1-(3-methylsulfonylcyclohexyl)propan-1-ol (PubChem CID 103147710) has the molecular formula C12H22F2O4S and a molecular weight of 300.37 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3-methylsulfonylcyclohexyl)propan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3-methylsulfonylcyclohexyl)propan-1-ol |
|---|---|
| PubChem CID | 103147710 |
| Molecular Formula | C12H22F2O4S |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3-methylsulfonylcyclohexyl)propan-1-ol |
| SMILES | CS(=O)(=O)C1CCCC(C(O)CCOCC(F)F)C1 |
| InChI | InChI=1S/C12H22F2O4S/c1-19(16,17)10-4-2-3-9(7-10)11(15)5-6-18-8-12(13)14/h9-12,15H,2-8H2,1H3 |
| InChIKey | MKVGTKZOKHMCHS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|