C12H20F4O4S — CID 103473949
1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103473949) has the molecular formula C12H20F4O4S and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103473949 |
| Molecular Formula | C12H20F4O4S |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | CS(=O)(=O)C1CCCC(C(O)COCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C12H20F4O4S/c1-21(18,19)9-4-2-3-8(5-9)10(17)6-20-7-12(15,16)11(13)14/h8-11,17H,2-7H2,1H3 |
| InChIKey | ZKXPUHQNJWWLHM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|