C32H36O4P2 — CID 102263454
[(2S,3S)-3-bis(4-methoxyphenyl)phosphanylbutan-2-yl]-bis(4-methoxyphenyl)phosphane (PubChem CID 102263454) has the molecular formula C32H36O4P2 and a molecular weight of 546.58 g/mol. Its IUPAC name is [(2S,3S)-3-bis(4-methoxyphenyl)phosphanylbutan-2-yl]-bis(4-methoxyphenyl)phosphane.
| Compound Name | [(2S,3S)-3-bis(4-methoxyphenyl)phosphanylbutan-2-yl]-bis(4-methoxyphenyl)phosphane |
|---|---|
| PubChem CID | 102263454 |
| Molecular Formula | C32H36O4P2 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | [(2S,3S)-3-bis(4-methoxyphenyl)phosphanylbutan-2-yl]-bis(4-methoxyphenyl)phosphane |
| SMILES | COc1ccc(P(c2ccc(OC)cc2)[C@@H](C)[C@H](C)P(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H36O4P2/c1-23(37(29-15-7-25(33-3)8-16-29)30-17-9-26(34-4)10-18-30)24(2)38(31-19-11-27(35-5)12-20-31)32-21-13-28(36-6)14-22-32/h7-24H,1-6H3/t23-,24-/m0/s1 |
| InChIKey | CKZNAUFKTLXYPH-ZEQRLZLVSA-N |
| XLogP | 6.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|