C25H26FN7O — CID 10226418
5-(4-aminobutoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 10226418) has the molecular formula C25H26FN7O and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-(4-aminobutoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(4-aminobutoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 10226418 |
| Molecular Formula | C25H26FN7O |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 5-(4-aminobutoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | NCCCCOCc1ccn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C25H26FN7O/c26-21-5-3-4-18(12-21)15-33-23-7-6-22(13-20(23)14-29-33)31-25-24-19(16-34-11-2-1-9-27)8-10-32(24)30-17-28-25/h3-8,10,12-14,17H,1-2,9,11,15-16,27H2,(H,28,30,31) |
| InChIKey | MRDZXMOZCRVRBY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|