About 6-bromo-1-methyl-3,4-diphenylisoquinoline
6-bromo-1-methyl-3,4-diphenylisoquinoline (PubChem CID 102264459) has the molecular formula C22H16BrN
and a molecular weight of 374.28 g/mol. Its IUPAC name is 6-bromo-1-methyl-3,4-diphenylisoquinoline.
Molecular Properties
| Compound Name | 6-bromo-1-methyl-3,4-diphenylisoquinoline |
| PubChem CID | 102264459 |
| Molecular Formula | C22H16BrN |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 6-bromo-1-methyl-3,4-diphenylisoquinoline |
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccccc2)c2cc(Br)ccc12 |
| InChI | InChI=1S/C22H16BrN/c1-15-19-13-12-18(23)14-20(19)21(16-8-4-2-5-9-16)22(24-15)17-10-6-3-7-11-17/h2-14H,1H3 |
| InChIKey | YCBYADGROGMDLZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1-methyl-3,4-diphenylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-methyl-3,4-diphenylisoquinoline?
The IUPAC name of 6-bromo-1-methyl-3,4-diphenylisoquinoline (CID 102264459) is 6-bromo-1-methyl-3,4-diphenylisoquinoline.
What is the SMILES notation for 6-bromo-1-methyl-3,4-diphenylisoquinoline?
The canonical SMILES for 6-bromo-1-methyl-3,4-diphenylisoquinoline is Cc1nc(-c2ccccc2)c(-c2ccccc2)c2cc(Br)ccc12.
What is the InChIKey of 6-bromo-1-methyl-3,4-diphenylisoquinoline?
The InChIKey is YCBYADGROGMDLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16BrN/c1-15-19-13-12-18(23)14-20(19)21(16-8-4-2-5-9-16)22(24-15)17-10-6-3-7-11-17/h2-14H,1H3.
What are the key properties of 6-bromo-1-methyl-3,4-diphenylisoquinoline?
6-bromo-1-methyl-3,4-diphenylisoquinoline has a molecular weight of 374.28 g/mol, XLogP of 6.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-methyl-3,4-diphenylisoquinoline is sourced from PubChem (CID 102264459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).