C20H20O2S2 — CID 102268227
(3aR,7aS)-1,1-bis(phenylsulfanyl)-3,3a,5,6,7,7a-hexahydro-2-benzofuran-4-one (PubChem CID 102268227) has the molecular formula C20H20O2S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (3aR,7aS)-1,1-bis(phenylsulfanyl)-3,3a,5,6,7,7a-hexahydro-2-benzofuran-4-one.
| Compound Name | (3aR,7aS)-1,1-bis(phenylsulfanyl)-3,3a,5,6,7,7a-hexahydro-2-benzofuran-4-one |
|---|---|
| PubChem CID | 102268227 |
| Molecular Formula | C20H20O2S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (3aR,7aS)-1,1-bis(phenylsulfanyl)-3,3a,5,6,7,7a-hexahydro-2-benzofuran-4-one |
| SMILES | O=C1CCC[C@H]2[C@@H]1COC2(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C20H20O2S2/c21-19-13-7-12-18-17(19)14-22-20(18,23-15-8-3-1-4-9-15)24-16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2/t17-,18-/m0/s1 |
| InChIKey | OQEKPXIEVYKKKX-ROUUACIJSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|