C16H20N2O2 — CID 102270246
(5E)-5-ethylidene-3,7,9,11-tetramethyl-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione (PubChem CID 102270246) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (5E)-5-ethylidene-3,7,9,11-tetramethyl-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione.
| Compound Name | (5E)-5-ethylidene-3,7,9,11-tetramethyl-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione |
|---|---|
| PubChem CID | 102270246 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (5E)-5-ethylidene-3,7,9,11-tetramethyl-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione |
| SMILES | C/C=C1\C2C(C)C34C1C1(C)C2C13C(=O)N(C)C(=O)N4C |
| InChI | InChI=1S/C16H20N2O2/c1-6-8-9-7(2)16-10(8)14(3)11(9)15(14,16)12(19)17(4)13(20)18(16)5/h6-7,9-11H,1-5H3/b8-6+ |
| InChIKey | HAUUZPMPCLWZMZ-SOFGYWHQSA-N |
| XLogP | 1.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|