C15H18N2O2 — CID 10801198
3,7,9,11-tetramethyl-5-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione (PubChem CID 10801198) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3,7,9,11-tetramethyl-5-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione.
| Compound Name | 3,7,9,11-tetramethyl-5-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione |
|---|---|
| PubChem CID | 10801198 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3,7,9,11-tetramethyl-5-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,6.04,8]dodecane-10,12-dione |
| SMILES | C=C1C2C(C)C34C1C1(C)C2C13C(=O)N(C)C(=O)N4C |
| InChI | InChI=1S/C15H18N2O2/c1-6-8-7(2)15-9(6)13(3)10(8)14(13,15)11(18)16(4)12(19)17(15)5/h7-10H,1H2,2-5H3 |
| InChIKey | DUCBZEKIXCAKMX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|