C15H18N2O2 — CID 10611226
3,5,10-trimethyl-8,12-dimethylidene-3,5-diazatetracyclo[7.2.1.01,6.06,10]dodecane-2,4-dione (PubChem CID 10611226) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3,5,10-trimethyl-8,12-dimethylidene-3,5-diazatetracyclo[7.2.1.01,6.06,10]dodecane-2,4-dione.
| Compound Name | 3,5,10-trimethyl-8,12-dimethylidene-3,5-diazatetracyclo[7.2.1.01,6.06,10]dodecane-2,4-dione |
|---|---|
| PubChem CID | 10611226 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3,5,10-trimethyl-8,12-dimethylidene-3,5-diazatetracyclo[7.2.1.01,6.06,10]dodecane-2,4-dione |
| SMILES | C=C1CC23N(C)C(=O)N(C)C(=O)C24CC3(C)C1C4=C |
| InChI | InChI=1S/C15H18N2O2/c1-8-6-15-13(3)7-14(15,9(2)10(8)13)11(18)16(4)12(19)17(15)5/h10H,1-2,6-7H2,3-5H3 |
| InChIKey | HDQCVMBQOSRQOH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|