C13H14N2O2 — CID 102152620
3,9-dimethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione (PubChem CID 102152620) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 3,9-dimethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione.
| Compound Name | 3,9-dimethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione |
|---|---|
| PubChem CID | 102152620 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3,9-dimethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione |
| SMILES | C=C1CC23C4C1C1C4(C)C12C(=O)NC(=O)N3C |
| InChI | InChI=1S/C13H14N2O2/c1-5-4-12-7-6(5)8-11(7,2)13(8,12)9(16)14-10(17)15(12)3/h6-8H,1,4H2,2-3H3,(H,14,16,17) |
| InChIKey | WPGQPDBZVQZBMY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|