C15H18N2O2 — CID 23232692
(2S,3R,4S,5S,8R)-2,4,9,11-tetramethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione (PubChem CID 23232692) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S,3R,4S,5S,8R)-2,4,9,11-tetramethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione.
| Compound Name | (2S,3R,4S,5S,8R)-2,4,9,11-tetramethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione |
|---|---|
| PubChem CID | 23232692 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (2S,3R,4S,5S,8R)-2,4,9,11-tetramethyl-6-methylidene-9,11-diazapentacyclo[6.4.0.01,3.02,5.04,8]dodecane-10,12-dione |
| SMILES | C=C1C[C@]23N(C)C(=O)N(C)C(=O)C24[C@@H]2C4(C)[C@H]1[C@@]23C |
| InChI | InChI=1S/C15H18N2O2/c1-7-6-14-12(2)8(7)13(3)9(12)15(13,14)10(18)16(4)11(19)17(14)5/h8-9H,1,6H2,2-5H3/t8-,9+,12+,13?,14-,15?/m1/s1 |
| InChIKey | ZYBRLEYFBZLWIM-DVFCKIOWSA-N |
| XLogP | 1.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|