C27H42N4O3 — CID 10227124
(2S,11S)-11-[[(2R,3S)-3-carbamoyl-2-(2-methylpropyl)hexyl]amino]-12-oxo-N-propan-2-yl-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 10227124) has the molecular formula C27H42N4O3 and a molecular weight of 470.66 g/mol. Its IUPAC name is (2S,11S)-11-[[(2R,3S)-3-carbamoyl-2-(2-methylpropyl)hexyl]amino]-12-oxo-N-propan-2-yl-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | (2S,11S)-11-[[(2R,3S)-3-carbamoyl-2-(2-methylpropyl)hexyl]amino]-12-oxo-N-propan-2-yl-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 10227124 |
| Molecular Formula | C27H42N4O3 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | (2S,11S)-11-[[(2R,3S)-3-carbamoyl-2-(2-methylpropyl)hexyl]amino]-12-oxo-N-propan-2-yl-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | CCC[C@H](C(N)=O)[C@H](CN[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NC(C)C)C3)CC(C)C |
| InChI | InChI=1S/C27H42N4O3/c1-6-8-21(25(28)32)20(13-16(2)3)15-29-22-12-11-18-9-7-10-19-14-23(26(33)30-17(4)5)31(24(18)19)27(22)34/h7,9-10,16-17,20-23,29H,6,8,11-15H2,1-5H3,(H2,28,32)(H,30,33)/t20-,21-,22-,23-/m0/s1 |
| InChIKey | CBPHADZHWFVHPE-MLCQCVOFSA-N |
| XLogP | 2.94 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |