C17H28O6 — CID 102271416
[(2S)-2-[(1R,2R,4aR,8R)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-2-hydroxypropyl] acetate (PubChem CID 102271416) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2S)-2-[(1R,2R,4aR,8R)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-2-hydroxypropyl] acetate.
| Compound Name | [(2S)-2-[(1R,2R,4aR,8R)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-2-hydroxypropyl] acetate |
|---|---|
| PubChem CID | 102271416 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(2S)-2-[(1R,2R,4aR,8R)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-2-hydroxypropyl] acetate |
| SMILES | CC(=O)OC[C@@](C)(O)[C@@H]1CC[C@@]2(C)C(=O)CC[C@@](C)(O)C2C1O |
| InChI | InChI=1S/C17H28O6/c1-10(18)23-9-17(4,22)11-5-7-15(2)12(19)6-8-16(3,21)14(15)13(11)20/h11,13-14,20-22H,5-9H2,1-4H3/t11-,13?,14?,15+,16-,17-/m1/s1 |
| InChIKey | IDUPHPDXRYYHDG-PAELUROOSA-N |
| XLogP | 0.81 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |