C15H23NO — CID 102272824
(4S,8R,11R,13S)-11-propan-2-yl-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one (PubChem CID 102272824) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (4S,8R,11R,13S)-11-propan-2-yl-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one.
| Compound Name | (4S,8R,11R,13S)-11-propan-2-yl-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one |
|---|---|
| PubChem CID | 102272824 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (4S,8R,11R,13S)-11-propan-2-yl-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one |
| SMILES | CC(C)[C@H]1CC[C@@H]2C=CC[C@H]3CCN1C(=O)[C@@H]32 |
| InChI | InChI=1S/C15H23NO/c1-10(2)13-7-6-11-4-3-5-12-8-9-16(13)15(17)14(11)12/h3-4,10-14H,5-9H2,1-2H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | SYVFJKUVDGLLCM-IGQOVBAYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|