C20H35NO — CID 134923150
2-butyl-7-hexyl-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-3-one (PubChem CID 134923150) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is 2-butyl-7-hexyl-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-3-one.
| Compound Name | 2-butyl-7-hexyl-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-3-one |
|---|---|
| PubChem CID | 134923150 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 2-butyl-7-hexyl-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-3-one |
| SMILES | CCCCCCC1=CC2CCC(=O)N(CCCC)CC2CC1 |
| InChI | InChI=1S/C20H35NO/c1-3-5-7-8-9-17-10-11-19-16-21(14-6-4-2)20(22)13-12-18(19)15-17/h15,18-19H,3-14,16H2,1-2H3 |
| InChIKey | SFHGPAURBVOTHS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|