C11H13F9IO3P — CID 102273458
(E)-1-diethoxyphosphoryl-4,4,5,5,6,6,7,7,7-nonafluoro-2-iodohept-1-ene (PubChem CID 102273458) has the molecular formula C11H13F9IO3P and a molecular weight of 522.08 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-4,4,5,5,6,6,7,7,7-nonafluoro-2-iodohept-1-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-4,4,5,5,6,6,7,7,7-nonafluoro-2-iodohept-1-ene |
|---|---|
| PubChem CID | 102273458 |
| Molecular Formula | C11H13F9IO3P |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.95 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-4,4,5,5,6,6,7,7,7-nonafluoro-2-iodohept-1-ene |
| SMILES | CCOP(=O)(/C=C(/I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCC |
| InChI | InChI=1S/C11H13F9IO3P/c1-3-23-25(22,24-4-2)6-7(21)5-8(12,13)9(14,15)10(16,17)11(18,19)20/h6H,3-5H2,1-2H3/b7-6+ |
| InChIKey | FZPMAUHPDUCPKP-VOTSOKGWSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|