C11H10F13O3P — CID 172797373
1-diethoxyphosphoryl-1,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-1-ene (PubChem CID 172797373) has the molecular formula C11H10F13O3P and a molecular weight of 468.15 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-1-ene.
| Compound Name | 1-diethoxyphosphoryl-1,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-1-ene |
|---|---|
| PubChem CID | 172797373 |
| Molecular Formula | C11H10F13O3P |
| Molecular Weight | 468.15 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 1-diethoxyphosphoryl-1,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-1-ene |
| SMILES | CCOP(=O)(OCC)C(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F13O3P/c1-3-26-28(25,27-4-2)6(13)5(12)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h3-4H2,1-2H3 |
| InChIKey | QJVTXHZJPXGOJG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.15 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|