C16H20F14O7P2 — CID 13196900
[(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate (PubChem CID 13196900) has the molecular formula C16H20F14O7P2 and a molecular weight of 652.25 g/mol. Its IUPAC name is [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate.
| Compound Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 13196900 |
| Molecular Formula | C16H20F14O7P2 |
| Molecular Weight | 652.25 g/mol |
| Exact Mass | 652.05 |
| IUPAC Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooct-1-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H20F14O7P2/c1-5-33-38(31,34-6-2)10(37-39(32,35-7-3)36-8-4)9(17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)30/h5-8H2,1-4H3/b10-9+ |
| InChIKey | PNCVTFVZUIUJBM-MDZDMXLPSA-N |
| XLogP | 8.33 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.25 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|