C17H20F16O7P2 — CID 134874140
[(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoronon-1-enyl] diethyl phosphate (PubChem CID 134874140) has the molecular formula C17H20F16O7P2 and a molecular weight of 702.26 g/mol. Its IUPAC name is [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoronon-1-enyl] diethyl phosphate.
| Compound Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoronon-1-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 134874140 |
| Molecular Formula | C17H20F16O7P2 |
| Molecular Weight | 702.26 g/mol |
| Exact Mass | 702.04 |
| IUPAC Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoronon-1-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H20F16O7P2/c1-5-36-41(34,37-6-2)10(40-42(35,38-7-3)39-8-4)9(18)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)33/h5-8H2,1-4H3/b10-9+ |
| InChIKey | FVMKZSWVPNLBKT-MDZDMXLPSA-N |
| XLogP | 8.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.26 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|