C15H20F12O7P2 — CID 134874255
[(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluorohept-1-enyl] diethyl phosphate (PubChem CID 134874255) has the molecular formula C15H20F12O7P2 and a molecular weight of 602.24 g/mol. Its IUPAC name is [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluorohept-1-enyl] diethyl phosphate.
| Compound Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluorohept-1-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 134874255 |
| Molecular Formula | C15H20F12O7P2 |
| Molecular Weight | 602.24 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluorohept-1-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H20F12O7P2/c1-5-30-35(28,31-6-2)10(34-36(29,32-7-3)33-8-4)9(16)11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)27/h5-8H2,1-4H3/b10-9+ |
| InChIKey | MYJRPUZDWSLQAE-MDZDMXLPSA-N |
| XLogP | 7.69 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.24 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|