C12H20F6O7P2 — CID 13196898
[(E)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-enyl] diethyl phosphate (PubChem CID 13196898) has the molecular formula C12H20F6O7P2 and a molecular weight of 452.22 g/mol. Its IUPAC name is [(E)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-enyl] diethyl phosphate.
| Compound Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 13196898 |
| Molecular Formula | C12H20F6O7P2 |
| Molecular Weight | 452.22 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | [(E)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(\F)C(F)(F)C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H20F6O7P2/c1-5-21-26(19,22-6-2)10(9(13)11(14,15)12(16,17)18)25-27(20,23-7-3)24-8-4/h5-8H2,1-4H3/b10-9+ |
| InChIKey | QURRBTAOVLQUJM-MDZDMXLPSA-N |
| XLogP | 5.79 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.22 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|