C10H10F13O3P — CID 12731014
1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (PubChem CID 12731014) has the molecular formula C10H10F13O3P and a molecular weight of 456.14 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane.
| Compound Name | 1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
|---|---|
| PubChem CID | 12731014 |
| Molecular Formula | C10H10F13O3P |
| Molecular Weight | 456.14 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F13O3P/c1-3-25-27(24,26-4-2)10(22,23)8(17,18)6(13,14)5(11,12)7(15,16)9(19,20)21/h3-4H2,1-2H3 |
| InChIKey | QMNAFMXDSMIWLU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.14 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|