C10H20F2IO3P — CID 10452569
1-diethoxyphosphoryl-1,1-difluoro-3-iodohexane (PubChem CID 10452569) has the molecular formula C10H20F2IO3P and a molecular weight of 384.14 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluoro-3-iodohexane.
| Compound Name | 1-diethoxyphosphoryl-1,1-difluoro-3-iodohexane |
|---|---|
| PubChem CID | 10452569 |
| Molecular Formula | C10H20F2IO3P |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluoro-3-iodohexane |
| SMILES | CCCC(I)CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H20F2IO3P/c1-4-7-9(13)8-10(11,12)17(14,15-5-2)16-6-3/h9H,4-8H2,1-3H3 |
| InChIKey | YKTOJZYWZPTARG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|