About 1-diethoxyphosphoryl-1,1-difluorononane
1-diethoxyphosphoryl-1,1-difluorononane (PubChem CID 10447514) has the molecular formula C13H27F2O3P
and a molecular weight of 300.33 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluorononane.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-1,1-difluorononane |
| PubChem CID | 10447514 |
| Molecular Formula | C13H27F2O3P |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluorononane |
| SMILES | CCCCCCCCC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H27F2O3P/c1-4-7-8-9-10-11-12-13(14,15)19(16,17-5-2)18-6-3/h4-12H2,1-3H3 |
| InChIKey | CECJSVFTYQPXKV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-1,1-difluorononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-1,1-difluorononane?
The IUPAC name of 1-diethoxyphosphoryl-1,1-difluorononane (CID 10447514) is 1-diethoxyphosphoryl-1,1-difluorononane.
What is the SMILES notation for 1-diethoxyphosphoryl-1,1-difluorononane?
The canonical SMILES for 1-diethoxyphosphoryl-1,1-difluorononane is CCCCCCCCC(F)(F)P(=O)(OCC)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-1,1-difluorononane?
The InChIKey is CECJSVFTYQPXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27F2O3P/c1-4-7-8-9-10-11-12-13(14,15)19(16,17-5-2)18-6-3/h4-12H2,1-3H3.
What are the key properties of 1-diethoxyphosphoryl-1,1-difluorononane?
1-diethoxyphosphoryl-1,1-difluorononane has a molecular weight of 300.33 g/mol, XLogP of 5.60, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-1,1-difluorononane is sourced from PubChem (CID 10447514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).