C13H27F2O3P — CID 10447514
1-diethoxyphosphoryl-1,1-difluorononane (PubChem CID 10447514) has the molecular formula C13H27F2O3P and a molecular weight of 300.33 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluorononane.
| Compound Name | 1-diethoxyphosphoryl-1,1-difluorononane |
|---|---|
| PubChem CID | 10447514 |
| Molecular Formula | C13H27F2O3P |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluorononane |
| SMILES | CCCCCCCCC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H27F2O3P/c1-4-7-8-9-10-11-12-13(14,15)19(16,17-5-2)18-6-3/h4-12H2,1-3H3 |
| InChIKey | CECJSVFTYQPXKV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|