C25H28Cl2N2O3 — CID 10227360
N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]cyclohexanecarbonyl]benzamide (PubChem CID 10227360) has the molecular formula C25H28Cl2N2O3 and a molecular weight of 475.42 g/mol. Its IUPAC name is N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]cyclohexanecarbonyl]benzamide.
| Compound Name | N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]cyclohexanecarbonyl]benzamide |
|---|---|
| PubChem CID | 10227360 |
| Molecular Formula | C25H28Cl2N2O3 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]cyclohexanecarbonyl]benzamide |
| SMILES | O=C(NC(=O)C1CCC(N2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H28Cl2N2O3/c26-22-11-10-21(16-23(22)27)32-20-12-14-29(15-13-20)19-8-6-18(7-9-19)25(31)28-24(30)17-4-2-1-3-5-17/h1-5,10-11,16,18-20H,6-9,12-15H2,(H,28,30,31) |
| InChIKey | QZZLGNLWUMZMGQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|