C10H8Br2F6O4 — CID 102274066
(1R,2R,4S,5S)-1,5-dibromo-2,4-dihydroxy-2,4-bis(trifluoromethyl)-3-oxabicyclo[3.3.1]nonan-9-one (PubChem CID 102274066) has the molecular formula C10H8Br2F6O4 and a molecular weight of 465.97 g/mol. Its IUPAC name is (1R,2R,4S,5S)-1,5-dibromo-2,4-dihydroxy-2,4-bis(trifluoromethyl)-3-oxabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1R,2R,4S,5S)-1,5-dibromo-2,4-dihydroxy-2,4-bis(trifluoromethyl)-3-oxabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 102274066 |
| Molecular Formula | C10H8Br2F6O4 |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 463.87 |
| IUPAC Name | (1R,2R,4S,5S)-1,5-dibromo-2,4-dihydroxy-2,4-bis(trifluoromethyl)-3-oxabicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1[C@]2(Br)CCC[C@@]1(Br)[C@](O)(C(F)(F)F)O[C@]2(O)C(F)(F)F |
| InChI | InChI=1S/C10H8Br2F6O4/c11-5-2-1-3-6(12,4(5)19)8(21,10(16,17)18)22-7(5,20)9(13,14)15/h20-21H,1-3H2/t5-,6+,7+,8- |
| InChIKey | PZDHJGADLACFCX-SOSBWXJGSA-N |
| XLogP | 2.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|