C10H12F3NO3 — CID 177403617
(6S,9S)-6-hydroxy-8-oxo-6-(trifluoromethyl)-7-azaspiro[3.5]nonane-9-carbaldehyde (PubChem CID 177403617) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is (6S,9S)-6-hydroxy-8-oxo-6-(trifluoromethyl)-7-azaspiro[3.5]nonane-9-carbaldehyde.
| Compound Name | (6S,9S)-6-hydroxy-8-oxo-6-(trifluoromethyl)-7-azaspiro[3.5]nonane-9-carbaldehyde |
|---|---|
| PubChem CID | 177403617 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (6S,9S)-6-hydroxy-8-oxo-6-(trifluoromethyl)-7-azaspiro[3.5]nonane-9-carbaldehyde |
| SMILES | O=C[C@H]1C(=O)N[C@@](O)(C(F)(F)F)CC12CCC2 |
| InChI | InChI=1S/C10H12F3NO3/c11-10(12,13)9(17)5-8(2-1-3-8)6(4-15)7(16)14-9/h4,6,17H,1-3,5H2,(H,14,16)/t6-,9-/m0/s1 |
| InChIKey | NFGGRALKWUBTNB-RCOVLWMOSA-N |
| XLogP | 0.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|