C6H6F6N2O2S — CID 97302177
(4S,6S)-4,6-dihydroxy-4,6-bis(trifluoromethyl)-1,3-diazinane-2-thione (PubChem CID 97302177) has the molecular formula C6H6F6N2O2S and a molecular weight of 284.18 g/mol. Its IUPAC name is (4S,6S)-4,6-dihydroxy-4,6-bis(trifluoromethyl)-1,3-diazinane-2-thione.
| Compound Name | (4S,6S)-4,6-dihydroxy-4,6-bis(trifluoromethyl)-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 97302177 |
| Molecular Formula | C6H6F6N2O2S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | (4S,6S)-4,6-dihydroxy-4,6-bis(trifluoromethyl)-1,3-diazinane-2-thione |
| SMILES | O[C@]1(C(F)(F)F)C[C@](O)(C(F)(F)F)NC(=S)N1 |
| InChI | InChI=1S/C6H6F6N2O2S/c7-5(8,9)3(15)1-4(16,6(10,11)12)14-2(17)13-3/h15-16H,1H2,(H2,13,14,17)/t3-,4-/m0/s1 |
| InChIKey | KTMKCFQWNNBDGJ-IMJSIDKUSA-N |
| XLogP | 0.36 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|