C7H10N4S2 — CID 130014414
2,4,6,8-tetrazatricyclo[3.3.3.01,5]undecane-3,7-dithione (PubChem CID 130014414) has the molecular formula C7H10N4S2 and a molecular weight of 214.32 g/mol. Its IUPAC name is 2,4,6,8-tetrazatricyclo[3.3.3.01,5]undecane-3,7-dithione.
| Compound Name | 2,4,6,8-tetrazatricyclo[3.3.3.01,5]undecane-3,7-dithione |
|---|---|
| PubChem CID | 130014414 |
| Molecular Formula | C7H10N4S2 |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2,4,6,8-tetrazatricyclo[3.3.3.01,5]undecane-3,7-dithione |
| SMILES | S=C1NC23CCCC2(N1)NC(=S)N3 |
| InChI | InChI=1S/C7H10N4S2/c12-4-8-6-2-1-3-7(6,10-4)11-5(13)9-6/h1-3H2,(H2,8,10,12)(H2,9,11,13) |
| InChIKey | LPNDFEDWOATKJE-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|