C14H27N3S — CID 100601184
2-methyl-1,2,4-triazaspiro[4.11]hexadecane-3-thione (PubChem CID 100601184) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 2-methyl-1,2,4-triazaspiro[4.11]hexadecane-3-thione.
| Compound Name | 2-methyl-1,2,4-triazaspiro[4.11]hexadecane-3-thione |
|---|---|
| PubChem CID | 100601184 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-methyl-1,2,4-triazaspiro[4.11]hexadecane-3-thione |
| SMILES | CN1NC2(CCCCCCCCCCC2)NC1=S |
| InChI | InChI=1S/C14H27N3S/c1-17-13(18)15-14(16-17)11-9-7-5-3-2-4-6-8-10-12-14/h16H,2-12H2,1H3,(H,15,18) |
| InChIKey | KIZDGYDAYUGRMO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|