C17H26N4S — CID 100600729
8-benzyl-2-butyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione (PubChem CID 100600729) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is 8-benzyl-2-butyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione.
| Compound Name | 8-benzyl-2-butyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione |
|---|---|
| PubChem CID | 100600729 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 8-benzyl-2-butyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione |
| SMILES | CCCCN1NC2(CCN(Cc3ccccc3)CC2)NC1=S |
| InChI | InChI=1S/C17H26N4S/c1-2-3-11-21-16(22)18-17(19-21)9-12-20(13-10-17)14-15-7-5-4-6-8-15/h4-8,19H,2-3,9-14H2,1H3,(H,18,22) |
| InChIKey | UHERPBWNZCZCRI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|