C13H25N7OS — CID 20836083
7-methyl-2-morpholin-4-ylspiro[1,2,3,3a,4,6-hexahydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cyclopentane]-8-thione (PubChem CID 20836083) has the molecular formula C13H25N7OS and a molecular weight of 327.46 g/mol. Its IUPAC name is 7-methyl-2-morpholin-4-ylspiro[1,2,3,3a,4,6-hexahydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cyclopentane]-8-thione.
| Compound Name | 7-methyl-2-morpholin-4-ylspiro[1,2,3,3a,4,6-hexahydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cyclopentane]-8-thione |
|---|---|
| PubChem CID | 20836083 |
| Molecular Formula | C13H25N7OS |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 7-methyl-2-morpholin-4-ylspiro[1,2,3,3a,4,6-hexahydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cyclopentane]-8-thione |
| SMILES | CN1NC2(CCCC2)NC2NC(N3CCOCC3)NN2C1=S |
| InChI | InChI=1S/C13H25N7OS/c1-18-12(22)20-10(15-13(17-18)4-2-3-5-13)14-11(16-20)19-6-8-21-9-7-19/h10-11,14-17H,2-9H2,1H3 |
| InChIKey | QWEIIVOISOGCJJ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|