C11H18ClNO3S — CID 134924469
2-chloro-3-morpholin-4-yl-1λ6-thiaspiro[3.4]octane 1,1-dioxide (PubChem CID 134924469) has the molecular formula C11H18ClNO3S and a molecular weight of 279.79 g/mol. Its IUPAC name is 2-chloro-3-morpholin-4-yl-1λ6-thiaspiro[3.4]octane 1,1-dioxide.
| Compound Name | 2-chloro-3-morpholin-4-yl-1λ6-thiaspiro[3.4]octane 1,1-dioxide |
|---|---|
| PubChem CID | 134924469 |
| Molecular Formula | C11H18ClNO3S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-chloro-3-morpholin-4-yl-1λ6-thiaspiro[3.4]octane 1,1-dioxide |
| SMILES | O=S1(=O)C(Cl)C(N2CCOCC2)C12CCCC2 |
| InChI | InChI=1S/C11H18ClNO3S/c12-10-9(13-5-7-16-8-6-13)11(17(10,14)15)3-1-2-4-11/h9-10H,1-8H2 |
| InChIKey | ICSBHSSIZSTZBI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|