About 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide
4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide (PubChem CID 3116740) has the molecular formula C11H19NO3S
and a molecular weight of 245.34 g/mol. Its IUPAC name is 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide |
| PubChem CID | 3116740 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide |
| SMILES | C=CC1C(N2CCOCC2)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C11H19NO3S/c1-4-9-10(11(2,3)16(9,13)14)12-5-7-15-8-6-12/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | PPKQIZNQFPCWJI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide?
The IUPAC name of 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide (CID 3116740) is 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide.
What is the SMILES notation for 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide?
The canonical SMILES for 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide is C=CC1C(N2CCOCC2)C(C)(C)S1(=O)=O.
What is the InChIKey of 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide?
The InChIKey is PPKQIZNQFPCWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3S/c1-4-9-10(11(2,3)16(9,13)14)12-5-7-15-8-6-12/h4,9-10H,1,5-8H2,2-3H3.
What are the key properties of 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide?
4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide has a molecular weight of 245.34 g/mol, XLogP of 0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide is sourced from PubChem (CID 3116740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).