C11H19NO3S — CID 3116740
4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide (PubChem CID 3116740) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide.
| Compound Name | 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide |
|---|---|
| PubChem CID | 3116740 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-ethenyl-2,2-dimethyl-3-morpholin-4-ylthietane 1,1-dioxide |
| SMILES | C=CC1C(N2CCOCC2)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C11H19NO3S/c1-4-9-10(11(2,3)16(9,13)14)12-5-7-15-8-6-12/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | PPKQIZNQFPCWJI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|