C13H26N2O2 — CID 24995982
4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)morpholine (PubChem CID 24995982) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)morpholine.
| Compound Name | 4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)morpholine |
|---|---|
| PubChem CID | 24995982 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)morpholine |
| SMILES | CC1(C)CC(N2CCOCC2)CC(C)(C)N1O |
| InChI | InChI=1S/C13H26N2O2/c1-12(2)9-11(10-13(3,4)15(12)16)14-5-7-17-8-6-14/h11,16H,5-10H2,1-4H3 |
| InChIKey | MNCCYFGBYNMYMK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |