C12H20ClNO3S — CID 98162855
(1R,7S,9R)-9-chloro-1-morpholin-4-yl-8λ6-thiabicyclo[5.2.0]nonane 8,8-dioxide (PubChem CID 98162855) has the molecular formula C12H20ClNO3S and a molecular weight of 293.82 g/mol. Its IUPAC name is (1R,7S,9R)-9-chloro-1-morpholin-4-yl-8λ6-thiabicyclo[5.2.0]nonane 8,8-dioxide.
| Compound Name | (1R,7S,9R)-9-chloro-1-morpholin-4-yl-8λ6-thiabicyclo[5.2.0]nonane 8,8-dioxide |
|---|---|
| PubChem CID | 98162855 |
| Molecular Formula | C12H20ClNO3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (1R,7S,9R)-9-chloro-1-morpholin-4-yl-8λ6-thiabicyclo[5.2.0]nonane 8,8-dioxide |
| SMILES | O=S1(=O)[C@H](Cl)[C@@]2(N3CCOCC3)CCCCC[C@@H]21 |
| InChI | InChI=1S/C12H20ClNO3S/c13-11-12(14-6-8-17-9-7-14)5-3-1-2-4-10(12)18(11,15)16/h10-11H,1-9H2/t10-,11-,12+/m0/s1 |
| InChIKey | NWBMSCJUQNCYMC-SDDRHHMPSA-N |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|