C8H14ClNO2 — CID 11263993
4-[(3S,4R)-4-chlorooxolan-3-yl]morpholine (PubChem CID 11263993) has the molecular formula C8H14ClNO2 and a molecular weight of 191.66 g/mol. Its IUPAC name is 4-[(3S,4R)-4-chlorooxolan-3-yl]morpholine.
| Compound Name | 4-[(3S,4R)-4-chlorooxolan-3-yl]morpholine |
|---|---|
| PubChem CID | 11263993 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-[(3S,4R)-4-chlorooxolan-3-yl]morpholine |
| SMILES | Cl[C@H]1COC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C8H14ClNO2/c9-7-5-12-6-8(7)10-1-3-11-4-2-10/h7-8H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | ZNSFSIKFNDOUSV-YUMQZZPRSA-N |
| XLogP | 0.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|