C9H15NO3 — CID 12820066
(1S,2R,4S,5R)-4-morpholin-4-yl-6-oxabicyclo[3.1.0]hexan-2-ol (PubChem CID 12820066) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (1S,2R,4S,5R)-4-morpholin-4-yl-6-oxabicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1S,2R,4S,5R)-4-morpholin-4-yl-6-oxabicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 12820066 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (1S,2R,4S,5R)-4-morpholin-4-yl-6-oxabicyclo[3.1.0]hexan-2-ol |
| SMILES | O[C@@H]1C[C@H](N2CCOCC2)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C9H15NO3/c11-7-5-6(8-9(7)13-8)10-1-3-12-4-2-10/h6-9,11H,1-5H2/t6-,7+,8+,9-/m0/s1 |
| InChIKey | GXQOBIGPGOCYTN-KDXUFGMBSA-N |
| XLogP | -0.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|