C9H18N2O2 — CID 110128732
(1R,2R,5R)-2-amino-5-morpholin-4-ylcyclopentan-1-ol (PubChem CID 110128732) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1R,2R,5R)-2-amino-5-morpholin-4-ylcyclopentan-1-ol.
| Compound Name | (1R,2R,5R)-2-amino-5-morpholin-4-ylcyclopentan-1-ol |
|---|---|
| PubChem CID | 110128732 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (1R,2R,5R)-2-amino-5-morpholin-4-ylcyclopentan-1-ol |
| SMILES | N[C@@H]1CC[C@@H](N2CCOCC2)[C@@H]1O |
| InChI | InChI=1S/C9H18N2O2/c10-7-1-2-8(9(7)12)11-3-5-13-6-4-11/h7-9,12H,1-6,10H2/t7-,8-,9-/m1/s1 |
| InChIKey | WISMQRLVRBAXAG-IWSPIJDZSA-N |
| XLogP | -0.83 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |