C8H16N2O — CID 130926079
trans-(1R,2R)-2-morpholin-4-ylcyclobutan-1-amine (PubChem CID 130926079) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is trans-(1R,2R)-2-morpholin-4-ylcyclobutan-1-amine.
| Compound Name | trans-(1R,2R)-2-morpholin-4-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 130926079 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | trans-(1R,2R)-2-morpholin-4-ylcyclobutan-1-amine |
| SMILES | N[C@@H]1CC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C8H16N2O/c9-7-1-2-8(7)10-3-5-11-6-4-10/h7-8H,1-6,9H2/t7-,8-/m1/s1 |
| InChIKey | LNEFCXBJCDUBRR-HTQZYQBOSA-N |
| XLogP | -0.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |