C23H45N6O2+ — CID 163179966
N,N-dicyclohexyl-4,6-dimorpholin-4-yl-1,3,5-triazinan-1-ium-2-amine (PubChem CID 163179966) has the molecular formula C23H45N6O2+ and a molecular weight of 437.65 g/mol. Its IUPAC name is N,N-dicyclohexyl-4,6-dimorpholin-4-yl-1,3,5-triazinan-1-ium-2-amine.
| Compound Name | N,N-dicyclohexyl-4,6-dimorpholin-4-yl-1,3,5-triazinan-1-ium-2-amine |
|---|---|
| PubChem CID | 163179966 |
| Molecular Formula | C23H45N6O2+ |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.36 |
| IUPAC Name | N,N-dicyclohexyl-4,6-dimorpholin-4-yl-1,3,5-triazinan-1-ium-2-amine |
| SMILES | C1CCC(N(C2CCCCC2)C2NC(N3CCOCC3)NC(N3CCOCC3)[NH2+]2)CC1 |
| InChI | InChI=1S/C23H44N6O2/c1-3-7-19(8-4-1)29(20-9-5-2-6-10-20)23-25-21(27-11-15-30-16-12-27)24-22(26-23)28-13-17-31-18-14-28/h19-26H,1-18H2/p+1 |
| InChIKey | XYYBYKAXZGWRDO-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 68.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |