C15H25N7OS — CID 135798417
7-methyl-2-morpholin-4-ylspiro[4,6-dihydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cycloheptane]-8-thione (PubChem CID 135798417) has the molecular formula C15H25N7OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 7-methyl-2-morpholin-4-ylspiro[4,6-dihydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cycloheptane]-8-thione.
| Compound Name | 7-methyl-2-morpholin-4-ylspiro[4,6-dihydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cycloheptane]-8-thione |
|---|---|
| PubChem CID | 135798417 |
| Molecular Formula | C15H25N7OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 7-methyl-2-morpholin-4-ylspiro[4,6-dihydro-[1,2,4]triazolo[1,5-d][1,2,4,6]tetrazepine-5,1'-cycloheptane]-8-thione |
| SMILES | CN1NC2(CCCCCC2)Nc2nc(N3CCOCC3)nn2C1=S |
| InChI | InChI=1S/C15H25N7OS/c1-20-14(24)22-12(16-13(18-22)21-8-10-23-11-9-21)17-15(19-20)6-4-2-3-5-7-15/h19H,2-11H2,1H3,(H,16,17,18) |
| InChIKey | SEXUOIMKFDFOLF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|