C13H21N9OS2 — CID 10643700
8,9,11,12-tetramethyl-4-morpholin-4-yl-1,3,5,6,8,9,11,12-octazatricyclo[8.3.0.02,6]trideca-2,4-diene-7,13-dithione (PubChem CID 10643700) has the molecular formula C13H21N9OS2 and a molecular weight of 383.51 g/mol. Its IUPAC name is 8,9,11,12-tetramethyl-4-morpholin-4-yl-1,3,5,6,8,9,11,12-octazatricyclo[8.3.0.02,6]trideca-2,4-diene-7,13-dithione.
| Compound Name | 8,9,11,12-tetramethyl-4-morpholin-4-yl-1,3,5,6,8,9,11,12-octazatricyclo[8.3.0.02,6]trideca-2,4-diene-7,13-dithione |
|---|---|
| PubChem CID | 10643700 |
| Molecular Formula | C13H21N9OS2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 8,9,11,12-tetramethyl-4-morpholin-4-yl-1,3,5,6,8,9,11,12-octazatricyclo[8.3.0.02,6]trideca-2,4-diene-7,13-dithione |
| SMILES | CN1C(=S)N2c3nc(N4CCOCC4)nn3C(=S)N(C)N(C)C2N1C |
| InChI | InChI=1S/C13H21N9OS2/c1-16-11-17(2)19(4)13(25)22-10(21(11)12(24)18(16)3)14-9(15-22)20-5-7-23-8-6-20/h11H,5-8H2,1-4H3 |
| InChIKey | KIVVJACBBJEPJD-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|