C8H12N2S2 — CID 171384862
1-methyl-1,3-diazaspiro[4.4]nonane-2,4-dithione (PubChem CID 171384862) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-methyl-1,3-diazaspiro[4.4]nonane-2,4-dithione.
| Compound Name | 1-methyl-1,3-diazaspiro[4.4]nonane-2,4-dithione |
|---|---|
| PubChem CID | 171384862 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-methyl-1,3-diazaspiro[4.4]nonane-2,4-dithione |
| SMILES | CN1C(=S)NC(=S)C12CCCC2 |
| InChI | InChI=1S/C8H12N2S2/c1-10-7(12)9-6(11)8(10)4-2-3-5-8/h2-5H2,1H3,(H,9,11,12) |
| InChIKey | BLUKSMOABYTPAM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|