C12H20N2O2 — CID 53388991
1-methyl-1,4-diazaspiro[5.7]tridecane-3,5-dione (PubChem CID 53388991) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-methyl-1,4-diazaspiro[5.7]tridecane-3,5-dione.
| Compound Name | 1-methyl-1,4-diazaspiro[5.7]tridecane-3,5-dione |
|---|---|
| PubChem CID | 53388991 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-methyl-1,4-diazaspiro[5.7]tridecane-3,5-dione |
| SMILES | CN1CC(=O)NC(=O)C12CCCCCCC2 |
| InChI | InChI=1S/C12H20N2O2/c1-14-9-10(15)13-11(16)12(14)7-5-3-2-4-6-8-12/h2-9H2,1H3,(H,13,15,16) |
| InChIKey | YXYSXPMVXNUEAJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|