C16H21N3O2 — CID 130597226
8-benzyl-1-methyl-1,4,8-triazaspiro[5.5]undecane-3,5-dione (PubChem CID 130597226) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 8-benzyl-1-methyl-1,4,8-triazaspiro[5.5]undecane-3,5-dione.
| Compound Name | 8-benzyl-1-methyl-1,4,8-triazaspiro[5.5]undecane-3,5-dione |
|---|---|
| PubChem CID | 130597226 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 8-benzyl-1-methyl-1,4,8-triazaspiro[5.5]undecane-3,5-dione |
| SMILES | CN1CC(=O)NC(=O)C12CCCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C16H21N3O2/c1-18-11-14(20)17-15(21)16(18)8-5-9-19(12-16)10-13-6-3-2-4-7-13/h2-4,6-7H,5,8-12H2,1H3,(H,17,20,21) |
| InChIKey | VPPBKLBKWAOLKN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|