C14H18N4O — CID 79960832
4-amino-9-benzyl-1,3,9-triazaspiro[4.5]dec-3-en-2-one (PubChem CID 79960832) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-amino-9-benzyl-1,3,9-triazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-amino-9-benzyl-1,3,9-triazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 79960832 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-amino-9-benzyl-1,3,9-triazaspiro[4.5]dec-3-en-2-one |
| SMILES | NC1=NC(=O)NC12CCCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C14H18N4O/c15-12-14(17-13(19)16-12)7-4-8-18(10-14)9-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H3,15,16,17,19) |
| InChIKey | QKIZXEUDGWAOLX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |