C17H20N4O2 — CID 47090391
3-(9-benzyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl)propanenitrile (PubChem CID 47090391) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(9-benzyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl)propanenitrile.
| Compound Name | 3-(9-benzyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl)propanenitrile |
|---|---|
| PubChem CID | 47090391 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-(9-benzyl-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-3-yl)propanenitrile |
| SMILES | N#CCCN1C(=O)NC2(CCCN(Cc3ccccc3)C2)C1=O |
| InChI | InChI=1S/C17H20N4O2/c18-9-5-11-21-15(22)17(19-16(21)23)8-4-10-20(13-17)12-14-6-2-1-3-7-14/h1-3,6-7H,4-5,8,10-13H2,(H,19,23) |
| InChIKey | IHLAWKNKYRXFAK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|