C25H29N3O3 — CID 90728701
9-benzyl-2,4-dioxo-N-(2-propan-2-ylphenyl)-1,9-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 90728701) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 9-benzyl-2,4-dioxo-N-(2-propan-2-ylphenyl)-1,9-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | 9-benzyl-2,4-dioxo-N-(2-propan-2-ylphenyl)-1,9-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 90728701 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 9-benzyl-2,4-dioxo-N-(2-propan-2-ylphenyl)-1,9-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)C1C(=O)NC2(CCCN(Cc3ccccc3)C2)C1=O |
| InChI | InChI=1S/C25H29N3O3/c1-17(2)19-11-6-7-12-20(19)26-23(30)21-22(29)25(27-24(21)31)13-8-14-28(16-25)15-18-9-4-3-5-10-18/h3-7,9-12,17,21H,8,13-16H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | NJZYZDAGHWFEIW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|